C17H15BrF2O — CID 166436706
(2S,6R)-4-bromo-2,6-bis(2-fluorophenyl)oxane (PubChem CID 166436706) has the molecular formula C17H15BrF2O and a molecular weight of 353.21 g/mol. Its IUPAC name is (2S,6R)-4-bromo-2,6-bis(2-fluorophenyl)oxane.
| Compound Name | (2S,6R)-4-bromo-2,6-bis(2-fluorophenyl)oxane |
|---|---|
| PubChem CID | 166436706 |
| Molecular Formula | C17H15BrF2O |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (2S,6R)-4-bromo-2,6-bis(2-fluorophenyl)oxane |
| SMILES | Fc1ccccc1[C@@H]1CC(Br)C[C@H](c2ccccc2F)O1 |
| InChI | InChI=1S/C17H15BrF2O/c18-11-9-16(12-5-1-3-7-14(12)19)21-17(10-11)13-6-2-4-8-15(13)20/h1-8,11,16-17H,9-10H2/t11?,16-,17+ |
| InChIKey | FWURTHWUCYQHTM-PPOQKSSISA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|