C12H14FIO — CID 125455276
(2S,5R)-5-(2-fluorophenyl)-2-(iodomethyl)oxane (PubChem CID 125455276) has the molecular formula C12H14FIO and a molecular weight of 320.14 g/mol. Its IUPAC name is (2S,5R)-5-(2-fluorophenyl)-2-(iodomethyl)oxane.
| Compound Name | (2S,5R)-5-(2-fluorophenyl)-2-(iodomethyl)oxane |
|---|---|
| PubChem CID | 125455276 |
| Molecular Formula | C12H14FIO |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (2S,5R)-5-(2-fluorophenyl)-2-(iodomethyl)oxane |
| SMILES | Fc1ccccc1[C@H]1CC[C@@H](CI)OC1 |
| InChI | InChI=1S/C12H14FIO/c13-12-4-2-1-3-11(12)9-5-6-10(7-14)15-8-9/h1-4,9-10H,5-8H2/t9-,10-/m0/s1 |
| InChIKey | DAXPBADPBLHCDJ-UWVGGRQHSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|