About 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine
2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine (PubChem CID 82158926) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine |
| PubChem CID | 82158926 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine |
| SMILES | NCCC1OCC(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C11H14ClNO2/c12-9-3-1-2-8(6-9)10-7-14-11(15-10)4-5-13/h1-3,6,10-11H,4-5,7,13H2 |
| InChIKey | QBSVGDUMKJVCNM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine?
The IUPAC name of 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine (CID 82158926) is 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine.
What is the SMILES notation for 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine?
The canonical SMILES for 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine is NCCC1OCC(c2cccc(Cl)c2)O1.
What is the InChIKey of 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine?
The InChIKey is QBSVGDUMKJVCNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2/c12-9-3-1-2-8(6-9)10-7-14-11(15-10)4-5-13/h1-3,6,10-11H,4-5,7,13H2.
What are the key properties of 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine?
2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine has a molecular weight of 227.69 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-chlorophenyl)-1,3-dioxolan-2-yl]ethanamine is sourced from PubChem (CID 82158926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).