C10H12ClO3P — CID 149326876
(2R,4S)-4-(3-chlorophenyl)-2-methyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 149326876) has the molecular formula C10H12ClO3P and a molecular weight of 246.63 g/mol. Its IUPAC name is (2R,4S)-4-(3-chlorophenyl)-2-methyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2R,4S)-4-(3-chlorophenyl)-2-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 149326876 |
| Molecular Formula | C10H12ClO3P |
| Molecular Weight | 246.63 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (2R,4S)-4-(3-chlorophenyl)-2-methyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | C[P@@]1(=O)OCC[C@@H](c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C10H12ClO3P/c1-15(12)13-6-5-10(14-15)8-3-2-4-9(11)7-8/h2-4,7,10H,5-6H2,1H3/t10-,15+/m0/s1 |
| InChIKey | YBNXAPOYTZJBGT-ZUZCIYMTSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|