C24H29ClFO13P — CID 174020757
[(2S)-2-fluoro-2-[(3S,6S)-3,4,5-triacetyloxy-6-[[(2R,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]oxan-2-yl]ethyl] acetate (PubChem CID 174020757) has the molecular formula C24H29ClFO13P and a molecular weight of 610.91 g/mol. Its IUPAC name is [(2S)-2-fluoro-2-[(3S,6S)-3,4,5-triacetyloxy-6-[[(2R,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]oxan-2-yl]ethyl] acetate.
| Compound Name | [(2S)-2-fluoro-2-[(3S,6S)-3,4,5-triacetyloxy-6-[[(2R,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]oxan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 174020757 |
| Molecular Formula | C24H29ClFO13P |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | [(2S)-2-fluoro-2-[(3S,6S)-3,4,5-triacetyloxy-6-[[(2R,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]oxan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@H](F)C1O[C@@H](O[P@]2(=O)OCC[C@H](c3cccc(Cl)c3)O2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H29ClFO13P/c1-12(27)32-11-18(26)20-21(34-13(2)28)22(35-14(3)29)23(36-15(4)30)24(37-20)39-40(31)33-9-8-19(38-40)16-6-5-7-17(25)10-16/h5-7,10,18-24H,8-9,11H2,1-4H3/t18-,19+,20?,21+,22?,23?,24-,40+/m0/s1 |
| InChIKey | IERKKNXEUHZAAN-FSJCETSZSA-N |
| XLogP | 3.36 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|