C21H23ClFN2O9P — CID 118096942
[(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate (PubChem CID 118096942) has the molecular formula C21H23ClFN2O9P and a molecular weight of 532.85 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 118096942 |
| Molecular Formula | C21H23ClFN2O9P |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](COP2(=O)OCCC(c3cccc(Cl)c3)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C21H23ClFN2O9P/c1-12(26)32-18-16(33-19(21(18,2)23)25-8-6-17(27)24-20(25)28)11-31-35(29)30-9-7-15(34-35)13-4-3-5-14(22)10-13/h3-6,8,10,15-16,18-19H,7,9,11H2,1-2H3,(H,24,27,28)/t15?,16-,18-,19-,21-,35?/m1/s1 |
| InChIKey | KPQNXMXVIWLSCX-DBTOJULVSA-N |
| XLogP | 3.05 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|