C23H28ClFN3O8P — CID 126628454
[(2R,3R,4R,5R)-2-[[6-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate (PubChem CID 126628454) has the molecular formula C23H28ClFN3O8P and a molecular weight of 559.92 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[6-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-[[6-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 126628454 |
| Molecular Formula | C23H28ClFN3O8P |
| Molecular Weight | 559.92 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[6-(3-chlorophenyl)-5,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](COP2(=O)NCC(C)(C)C(c3cccc(Cl)c3)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C23H28ClFN3O8P/c1-13(29)34-19-16(35-20(23(19,4)25)28-9-8-17(30)27-21(28)31)11-33-37(32)26-12-22(2,3)18(36-37)14-6-5-7-15(24)10-14/h5-10,16,18-20H,11-12H2,1-4H3,(H,26,32)(H,27,30,31)/t16-,18?,19-,20-,23-,37?/m1/s1 |
| InChIKey | HRPCOOLJYDXVHS-BULIWQTKSA-N |
| XLogP | 3.26 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|