C27H35FN3O10P — CID 118221440
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate (PubChem CID 118221440) has the molecular formula C27H35FN3O10P and a molecular weight of 611.56 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118221440 |
| Molecular Formula | C27H35FN3O10P |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccc(C3CC3)cc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C27H35FN3O10P/c1-15(2)38-24(34)16(3)30-42(36,41-20-10-8-19(9-11-20)18-6-7-18)37-14-21-23(39-17(4)32)27(5,28)25(40-21)31-13-12-22(33)29-26(31)35/h8-13,15-16,18,21,23,25H,6-7,14H2,1-5H3,(H,30,36)(H,29,33,35)/t16-,21+,23+,25+,27+,42-/m0/s1 |
| InChIKey | ZFSHLJXSOPWCQY-ATZNPQOTSA-N |
| XLogP | 3.10 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|