C22H23ClN5O13P — CID 91300447
[(2R,3S,4R,5R)-2-azido-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-methoxycarbonyloxyoxolan-3-yl] methyl carbonate (PubChem CID 91300447) has the molecular formula C22H23ClN5O13P and a molecular weight of 631.88 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-azido-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-methoxycarbonyloxyoxolan-3-yl] methyl carbonate.
| Compound Name | [(2R,3S,4R,5R)-2-azido-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-methoxycarbonyloxyoxolan-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 91300447 |
| Molecular Formula | C22H23ClN5O13P |
| Molecular Weight | 631.88 g/mol |
| Exact Mass | 631.07 |
| IUPAC Name | [(2R,3S,4R,5R)-2-azido-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-methoxycarbonyloxyoxolan-3-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@@](CO[P@@]2(=O)OCC[C@@H](c3cccc(Cl)c3)O2)(N=[N+]=[N-])[C@H]1OC(=O)OC |
| InChI | InChI=1S/C22H23ClN5O13P/c1-34-20(31)38-16-17(39-21(32)35-2)22(26-27-24,40-18(16)28-8-6-15(29)25-19(28)30)11-37-42(33)36-9-7-14(41-42)12-4-3-5-13(23)10-12/h3-6,8,10,14,16-18H,7,9,11H2,1-2H3,(H,25,29,30)/t14-,16+,17-,18+,22+,42+/m0/s1 |
| InChIKey | PKHXXWQBVXWREZ-KUGDEOCASA-N |
| XLogP | 3.33 |
| TPSA | 228.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|