C18H18ClFN5O9P — CID 90857274
1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-chloro-4-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90857274) has the molecular formula C18H18ClFN5O9P and a molecular weight of 533.79 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-chloro-4-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-chloro-4-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90857274 |
| Molecular Formula | C18H18ClFN5O9P |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-chloro-4-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(CO[P@]2(=O)OCC[C@H](c3ccc(F)cc3Cl)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18ClFN5O9P/c19-11-7-9(20)1-2-10(11)12-4-6-31-35(30,34-12)32-8-18(23-24-21)15(28)14(27)16(33-18)25-5-3-13(26)22-17(25)29/h1-3,5,7,12,14-16,27-28H,4,6,8H2,(H,22,26,29)/t12-,14-,15+,16-,18-,35+/m1/s1 |
| InChIKey | BMSMRQJSUPNNHM-ZEAIOTDOSA-N |
| XLogP | 1.89 |
| TPSA | 198.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|