C18H19BrN5O9P — CID 91369984
1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 91369984) has the molecular formula C18H19BrN5O9P and a molecular weight of 560.25 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91369984 |
| Molecular Formula | C18H19BrN5O9P |
| Molecular Weight | 560.25 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-azido-5-[[(2S,4R)-4-(2-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(CO[P@]2(=O)OCC[C@H](c3ccccc3Br)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19BrN5O9P/c19-11-4-2-1-3-10(11)12-6-8-30-34(29,33-12)31-9-18(22-23-20)15(27)14(26)16(32-18)24-7-5-13(25)21-17(24)28/h1-5,7,12,14-16,26-27H,6,8-9H2,(H,21,25,28)/t12-,14-,15+,16-,18-,34+/m1/s1 |
| InChIKey | VRYYZELIQGDGIL-USCIZKFDSA-N |
| XLogP | 1.86 |
| TPSA | 198.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|