C19H19F3N5O9P — CID 42624238
1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 42624238) has the molecular formula C19H19F3N5O9P and a molecular weight of 549.36 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 42624238 |
| Molecular Formula | C19H19F3N5O9P |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(COP2(=O)OCC[C@@H](c3cccc(C(F)(F)F)c3)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H19F3N5O9P/c20-19(21,22)11-3-1-2-10(8-11)12-5-7-33-37(32,36-12)34-9-18(25-26-23)15(30)14(29)16(35-18)27-6-4-13(28)24-17(27)31/h1-4,6,8,12,14-16,29-30H,5,7,9H2,(H,24,28,31)/t12-,14+,15-,16+,18+,37?/m0/s1 |
| InChIKey | KMRHTKIHOJNLDY-RLILCHSSSA-N |
| XLogP | 2.12 |
| TPSA | 198.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|