C19H19N6O9P — CID 173487139
4-[(4S)-2-[[(2R,3S,4R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzonitrile (PubChem CID 173487139) has the molecular formula C19H19N6O9P and a molecular weight of 506.37 g/mol. Its IUPAC name is 4-[(4S)-2-[[(2R,3S,4R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzonitrile.
| Compound Name | 4-[(4S)-2-[[(2R,3S,4R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzonitrile |
|---|---|
| PubChem CID | 173487139 |
| Molecular Formula | C19H19N6O9P |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 4-[(4S)-2-[[(2R,3S,4R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2CCOP(=O)(OC[C@@]3(N=[N+]=[N-])OC(n4ccc(=O)[nH]c4=O)[C@H](O)[C@@H]3O)O2)cc1 |
| InChI | InChI=1S/C19H19N6O9P/c20-9-11-1-3-12(4-2-11)13-6-8-31-35(30,34-13)32-10-19(23-24-21)16(28)15(27)17(33-19)25-7-5-14(26)22-18(25)29/h1-5,7,13,15-17,27-28H,6,8,10H2,(H,22,26,29)/t13-,15+,16-,17?,19+,35?/m0/s1 |
| InChIKey | ZJWRVQVCGYSGSN-GHBFHWCKSA-N |
| XLogP | 0.97 |
| TPSA | 221.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|