C17H19N6O9P — CID 42624048
1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 42624048) has the molecular formula C17H19N6O9P and a molecular weight of 482.35 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 42624048 |
| Molecular Formula | C17H19N6O9P |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@]1(COP2(=O)OCC[C@@H](c3ccncc3)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19N6O9P/c18-22-21-17(14(26)13(25)15(31-17)23-7-3-12(24)20-16(23)27)9-30-33(28)29-8-4-11(32-33)10-1-5-19-6-2-10/h1-3,5-7,11,13-15,25-26H,4,8-9H2,(H,20,24,27)/t11-,13+,14-,15+,17+,33?/m0/s1 |
| InChIKey | NTEQNEODEMSTGH-QLNZMUPLSA-N |
| XLogP | 0.49 |
| TPSA | 210.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|