C15H21FO10 — CID 155091236
[2-fluoro-2-[(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]ethyl] acetate (PubChem CID 155091236) has the molecular formula C15H21FO10 and a molecular weight of 380.32 g/mol. Its IUPAC name is [2-fluoro-2-[(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]ethyl] acetate.
| Compound Name | [2-fluoro-2-[(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 155091236 |
| Molecular Formula | C15H21FO10 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [2-fluoro-2-[(2S,3S,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OCC(F)[C@H]1OC(O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21FO10/c1-6(17)22-5-10(16)11-12(23-7(2)18)13(24-8(3)19)14(15(21)26-11)25-9(4)20/h10-15,21H,5H2,1-4H3/t10?,11-,12-,13+,14+,15?/m1/s1 |
| InChIKey | MAXYFNFZYDQDMG-DXHQICAJSA-N |
| XLogP | -0.60 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|