C18H19ClF2N3O7P — CID 164942896
4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 164942896) has the molecular formula C18H19ClF2N3O7P and a molecular weight of 493.79 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 164942896 |
| Molecular Formula | C18H19ClF2N3O7P |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | O=c1nc(NP2(=O)OCCC(c3cccc(Cl)c3)O2)ccn1[C@@H]1O[C@H](CO)[C@H](O)C1(F)F |
| InChI | InChI=1S/C18H19ClF2N3O7P/c19-11-3-1-2-10(8-11)12-5-7-29-32(28,31-12)23-14-4-6-24(17(27)22-14)16-18(20,21)15(26)13(9-25)30-16/h1-4,6,8,12-13,15-16,25-26H,5,7,9H2,(H,22,23,27,28)/t12?,13-,15+,16-,32?/m1/s1 |
| InChIKey | JLDTYFGTXZMRCM-PDEREGENSA-N |
| XLogP | 2.48 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|