C18H20F2N3O8P — CID 166059881
1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]pyrimidin-2-one (PubChem CID 166059881) has the molecular formula C18H20F2N3O8P and a molecular weight of 475.34 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]pyrimidin-2-one.
| Compound Name | 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 166059881 |
| Molecular Formula | C18H20F2N3O8P |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphospholan-2-yl]amino]pyrimidin-2-one |
| SMILES | COc1ccc(C2COP(=O)(Nc3ccn([C@@H]4O[C@H](CO)[C@@H](O)C4(F)F)c(=O)n3)O2)cc1 |
| InChI | InChI=1S/C18H20F2N3O8P/c1-28-11-4-2-10(3-5-11)13-9-29-32(27,31-13)22-14-6-7-23(17(26)21-14)16-18(19,20)15(25)12(8-24)30-16/h2-7,12-13,15-16,24-25H,8-9H2,1H3,(H,21,22,26,27)/t12-,13?,15-,16-,32?/m1/s1 |
| InChIKey | PVVKPQHPNDHSQQ-LQCUJVMXSA-N |
| XLogP | 1.45 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|