C17H19F2N4O7P — CID 164942902
1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[(2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl)amino]pyrimidin-2-one (PubChem CID 164942902) has the molecular formula C17H19F2N4O7P and a molecular weight of 460.33 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[(2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl)amino]pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[(2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl)amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 164942902 |
| Molecular Formula | C17H19F2N4O7P |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[(2-oxo-4-pyridin-3-yl-1,3,2λ5-dioxaphosphinan-2-yl)amino]pyrimidin-2-one |
| SMILES | O=c1nc(NP2(=O)OCCC(c3cccnc3)O2)ccn1[C@@H]1O[C@H](CO)[C@H](O)C1(F)F |
| InChI | InChI=1S/C17H19F2N4O7P/c18-17(19)14(25)12(9-24)29-15(17)23-6-3-13(21-16(23)26)22-31(27)28-7-4-11(30-31)10-2-1-5-20-8-10/h1-3,5-6,8,11-12,14-15,24-25H,4,7,9H2,(H,21,22,26,27)/t11?,12-,14+,15-,31?/m1/s1 |
| InChIKey | VIKCEQIWPXXDFW-HWNMSATNSA-N |
| XLogP | 1.22 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|