C18H18ClF3N3O7P — CID 155624115
4-amino-1-[(2R,4R,5R)-5-[[(4R)-4-(3-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 155624115) has the molecular formula C18H18ClF3N3O7P and a molecular weight of 511.78 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-5-[[(4R)-4-(3-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5R)-5-[[(4R)-4-(3-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 155624115 |
| Molecular Formula | C18H18ClF3N3O7P |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-5-[[(4R)-4-(3-chloro-2-fluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP3(=O)OCC[C@H](c4cccc(Cl)c4F)O3)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C18H18ClF3N3O7P/c19-10-3-1-2-9(14(10)20)11-5-7-29-33(28,32-11)30-8-12-15(26)18(21,22)16(31-12)25-6-4-13(23)24-17(25)27/h1-4,6,11-12,15-16,26H,5,7-8H2,(H2,23,24,27)/t11-,12-,15-,16-,33?/m1/s1 |
| InChIKey | QYGAQQXXULLELA-HYCNQWAOSA-N |
| XLogP | 2.81 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|