C18H20F2N3O8P — CID 155624215
4-amino-1-[(2R,3S,4S,5R)-5-[[(4R)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 155624215) has the molecular formula C18H20F2N3O8P and a molecular weight of 475.34 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4S,5R)-5-[[(4R)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4S,5R)-5-[[(4R)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 155624215 |
| Molecular Formula | C18H20F2N3O8P |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 4-amino-1-[(2R,3S,4S,5R)-5-[[(4R)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP3(=O)OCC[C@H](c4cc(F)cc(F)c4)O3)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C18H20F2N3O8P/c19-10-5-9(6-11(20)7-10)12-2-4-28-32(27,31-12)29-8-13-15(24)16(25)17(30-13)23-3-1-14(21)22-18(23)26/h1,3,5-7,12-13,15-17,24-25H,2,4,8H2,(H2,21,22,26)/t12-,13-,15-,16+,17-,32?/m1/s1 |
| InChIKey | KRLFYTZLYYEWIW-MEAWQKJBSA-N |
| XLogP | 1.03 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|