C20H24N3O10P — CID 73352889
methyl 4-[(4R)-2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzoate (PubChem CID 73352889) has the molecular formula C20H24N3O10P and a molecular weight of 497.40 g/mol. Its IUPAC name is methyl 4-[(4R)-2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzoate.
| Compound Name | methyl 4-[(4R)-2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzoate |
|---|---|
| PubChem CID | 73352889 |
| Molecular Formula | C20H24N3O10P |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | methyl 4-[(4R)-2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2CCOP(=O)(OC[C@H]3O[C@@H](n4ccc(N)nc4=O)[C@@H](O)[C@@H]3O)O2)cc1 |
| InChI | InChI=1S/C20H24N3O10P/c1-29-19(26)12-4-2-11(3-5-12)13-7-9-30-34(28,33-13)31-10-14-16(24)17(25)18(32-14)23-8-6-15(21)22-20(23)27/h2-6,8,13-14,16-18,24-25H,7,9-10H2,1H3,(H2,21,22,27)/t13-,14-,16-,17+,18-,34?/m1/s1 |
| InChIKey | KBGCHXHTGYYBMH-YRXFZGLVSA-N |
| XLogP | 0.53 |
| TPSA | 181.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|