C19H21ClN5O4P — CID 146857628
N-[9-[2-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2-tritioethyl]purin-6-yl]ethanimine (PubChem CID 146857628) has the molecular formula C19H21ClN5O4P and a molecular weight of 451.84 g/mol. Its IUPAC name is N-[9-[2-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2-tritioethyl]purin-6-yl]ethanimine.
| Compound Name | N-[9-[2-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2-tritioethyl]purin-6-yl]ethanimine |
|---|---|
| PubChem CID | 146857628 |
| Molecular Formula | C19H21ClN5O4P |
| Molecular Weight | 451.84 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[9-[2-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2-tritioethyl]purin-6-yl]ethanimine |
| SMILES | [3H]C(Cn1cnc2c(N=CC)ncnc21)OCP1(=O)OCC[C@@H](c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C19H21ClN5O4P/c1-2-21-18-17-19(23-11-22-18)25(12-24-17)7-9-27-13-30(26)28-8-6-16(29-30)14-4-3-5-15(20)10-14/h2-5,10-12,16H,6-9,13H2,1H3/t16-,30?/m0/s1/i9T/t9?,16-,30? |
| InChIKey | SJXMNPSXKZPLFT-JCMAHZTKSA-N |
| XLogP | 4.55 |
| TPSA | 100.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|