C17H19ClN5O4P — CID 24777067
9-[2-[[4-(2-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-amine (PubChem CID 24777067) has the molecular formula C17H19ClN5O4P and a molecular weight of 423.80 g/mol. Its IUPAC name is 9-[2-[[4-(2-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[[4-(2-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 24777067 |
| Molecular Formula | C17H19ClN5O4P |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 9-[2-[[4-(2-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP1(=O)OCCC(c2ccccc2Cl)O1 |
| InChI | InChI=1S/C17H19ClN5O4P/c18-13-4-2-1-3-12(13)14-5-7-26-28(24,27-14)11-25-8-6-23-10-22-15-16(19)20-9-21-17(15)23/h1-4,9-10,14H,5-8,11H2,(H2,19,20,21) |
| InChIKey | CKCFVIOMZSQDNX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|