C16H19N6O3P — CID 24764114
9-[2-[(4-methyl-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine (PubChem CID 24764114) has the molecular formula C16H19N6O3P and a molecular weight of 374.34 g/mol. Its IUPAC name is 9-[2-[(4-methyl-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[(4-methyl-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 24764114 |
| Molecular Formula | C16H19N6O3P |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 9-[2-[(4-methyl-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
| SMILES | CC1OP(=O)(COCCn2cnc3c(N)ncnc32)Nc2ccccc21 |
| InChI | InChI=1S/C16H19N6O3P/c1-11-12-4-2-3-5-13(12)21-26(23,25-11)10-24-7-6-22-9-20-14-15(17)18-8-19-16(14)22/h2-5,8-9,11H,6-7,10H2,1H3,(H,21,23)(H2,17,18,19) |
| InChIKey | IOFQCGGIUJJGEJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|