C15H16FN6O3P — CID 11595988
9-[2-[(5-fluoro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine (PubChem CID 11595988) has the molecular formula C15H16FN6O3P and a molecular weight of 378.30 g/mol. Its IUPAC name is 9-[2-[(5-fluoro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine.
| Compound Name | 9-[2-[(5-fluoro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 11595988 |
| Molecular Formula | C15H16FN6O3P |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 9-[2-[(5-fluoro-2-oxo-1,4-dihydro-3,1,2λ5-benzoxazaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCOCP1(=O)Nc2cccc(F)c2CO1 |
| InChI | InChI=1S/C15H16FN6O3P/c16-11-2-1-3-12-10(11)6-25-26(23,21-12)9-24-5-4-22-8-20-13-14(17)18-7-19-15(13)22/h1-3,7-8H,4-6,9H2,(H,21,23)(H2,17,18,19) |
| InChIKey | BXLGWHJTULIGEH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|