C18H21ClN5O7PS — CID 89147009
[[9-[2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-yl]amino] methanesulfonate (PubChem CID 89147009) has the molecular formula C18H21ClN5O7PS and a molecular weight of 517.89 g/mol. Its IUPAC name is [[9-[2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-yl]amino] methanesulfonate.
| Compound Name | [[9-[2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-yl]amino] methanesulfonate |
|---|---|
| PubChem CID | 89147009 |
| Molecular Formula | C18H21ClN5O7PS |
| Molecular Weight | 517.89 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | [[9-[2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]purin-6-yl]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ONc1ncnc2c1ncn2CCOC[P@@]1(=O)OCC[C@@H](c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C18H21ClN5O7PS/c1-33(26,27)31-23-17-16-18(21-10-20-17)24(11-22-16)6-8-28-12-32(25)29-7-5-15(30-32)13-3-2-4-14(19)9-13/h2-4,9-11,15H,5-8,12H2,1H3,(H,20,21,23)/t15-,32+/m0/s1 |
| InChIKey | NZXAWOOIXPQUCY-BBFFTDKLSA-N |
| XLogP | 3.13 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|