C26H30Cl2N5O7P — CID 157268747
2-amino-9-[2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one;1-(3-chlorophenyl)propane-1,3-diol (PubChem CID 157268747) has the molecular formula C26H30Cl2N5O7P and a molecular weight of 626.43 g/mol. Its IUPAC name is 2-amino-9-[2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one;1-(3-chlorophenyl)propane-1,3-diol.
| Compound Name | 2-amino-9-[2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one;1-(3-chlorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 157268747 |
| Molecular Formula | C26H30Cl2N5O7P |
| Molecular Weight | 626.43 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | 2-amino-9-[2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one;1-(3-chlorophenyl)propane-1,3-diol |
| SMILES | Nc1nc2c(ncn2CCOCP2(=O)OCCC(c3cccc(Cl)c3)O2)c(=O)[nH]1.OCCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H19ClN5O5P.C9H11ClO2/c18-12-3-1-2-11(8-12)13-4-6-27-29(25,28-13)10-26-7-5-23-9-20-14-15(23)21-17(19)22-16(14)24;10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,8-9,13H,4-7,10H2,(H3,19,21,22,24);1-3,6,9,11-12H,4-5H2 |
| InChIKey | AYHGDGGSOAYTQE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|