C19H24N5O5P — CID 137146577
2-amino-9-[2-[(4-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one (PubChem CID 137146577) has the molecular formula C19H24N5O5P and a molecular weight of 433.41 g/mol. Its IUPAC name is 2-amino-9-[2-[(4-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[(4-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137146577 |
| Molecular Formula | C19H24N5O5P |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-amino-9-[2-[(4-tert-butyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one |
| SMILES | CC(C)(C)C1OP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)Oc2ccccc21 |
| InChI | InChI=1S/C19H24N5O5P/c1-19(2,3)15-12-6-4-5-7-13(12)28-30(26,29-15)11-27-9-8-24-10-21-14-16(24)22-18(20)23-17(14)25/h4-7,10,15H,8-9,11H2,1-3H3,(H3,20,22,23,25) |
| InChIKey | KYWBPWUJXSDPMG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|