C15H15ClN5O5P — CID 136953819
2-amino-9-[2-[(8-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953819) has the molecular formula C15H15ClN5O5P and a molecular weight of 411.74 g/mol. Its IUPAC name is 2-amino-9-[2-[(8-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[(8-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953819 |
| Molecular Formula | C15H15ClN5O5P |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-amino-9-[2-[(8-chloro-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP2(=O)OCc3cccc(Cl)c3O2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H15ClN5O5P/c16-10-3-1-2-9-6-25-27(23,26-12(9)10)8-24-5-4-21-7-18-11-13(21)19-15(17)20-14(11)22/h1-3,7H,4-6,8H2,(H3,17,19,20,22) |
| InChIKey | CWXHAAHVFAHFQC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|