C32H44ClO5P — CID 143339835
(2S)-4-(3-chlorophenyl)-2-[(4-ethyl-3,5-dimethylcyclohepta-1,3,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide;(3Z,5Z,7Z)-2,3-dimethylnona-3,5,7-trien-4-ol (PubChem CID 143339835) has the molecular formula C32H44ClO5P and a molecular weight of 575.13 g/mol. Its IUPAC name is (2S)-4-(3-chlorophenyl)-2-[(4-ethyl-3,5-dimethylcyclohepta-1,3,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide;(3Z,5Z,7Z)-2,3-dimethylnona-3,5,7-trien-4-ol.
| Compound Name | (2S)-4-(3-chlorophenyl)-2-[(4-ethyl-3,5-dimethylcyclohepta-1,3,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide;(3Z,5Z,7Z)-2,3-dimethylnona-3,5,7-trien-4-ol |
|---|---|
| PubChem CID | 143339835 |
| Molecular Formula | C32H44ClO5P |
| Molecular Weight | 575.13 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (2S)-4-(3-chlorophenyl)-2-[(4-ethyl-3,5-dimethylcyclohepta-1,3,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide;(3Z,5Z,7Z)-2,3-dimethylnona-3,5,7-trien-4-ol |
| SMILES | C/C=C\C=C/C(O)=C(\C)C(C)C.CCC1=C(C)C=C(OC[P@]2(=O)OCCC(c3cccc(Cl)c3)O2)C=CC1C |
| InChI | InChI=1S/C21H26ClO4P.C11H18O/c1-4-20-15(2)8-9-19(12-16(20)3)24-14-27(23)25-11-10-21(26-27)17-6-5-7-18(22)13-17;1-5-6-7-8-11(12)10(4)9(2)3/h5-9,12-13,15,21H,4,10-11,14H2,1-3H3;5-9,12H,1-4H3/b;6-5-,8-7-,11-10-/t15?,21?,27-;/m0./s1 |
| InChIKey | BLAHEAHUQHACML-ZDDQNNRPSA-N |
| XLogP | 10.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.13 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|