C33H46ClO5P — CID 143339894
(2E,4E)-6-[4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]-3-ethyl-5-methylhexa-2,4-dien-2-ol;propane;prop-1-yne (PubChem CID 143339894) has the molecular formula C33H46ClO5P and a molecular weight of 589.15 g/mol. Its IUPAC name is (2E,4E)-6-[4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]-3-ethyl-5-methylhexa-2,4-dien-2-ol;propane;prop-1-yne.
| Compound Name | (2E,4E)-6-[4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]-3-ethyl-5-methylhexa-2,4-dien-2-ol;propane;prop-1-yne |
|---|---|
| PubChem CID | 143339894 |
| Molecular Formula | C33H46ClO5P |
| Molecular Weight | 589.15 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | (2E,4E)-6-[4-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]-2,6-dimethylphenyl]-3-ethyl-5-methylhexa-2,4-dien-2-ol;propane;prop-1-yne |
| SMILES | C#CC.CCC.CCC(/C=C(\C)Cc1c(C)cc(OCP2(=O)OCCC(c3cccc(Cl)c3)O2)cc1C)=C(/C)O |
| InChI | InChI=1S/C27H34ClO5P.C3H8.C3H4/c1-6-22(21(5)29)12-18(2)13-26-19(3)14-25(15-20(26)4)31-17-34(30)32-11-10-27(33-34)23-8-7-9-24(28)16-23;2*1-3-2/h7-9,12,14-16,27,29H,6,10-11,13,17H2,1-5H3;3H2,1-2H3;1H,2H3/b18-12+,22-21+;; |
| InChIKey | VYYSTSPCKMLQSR-MXSCHRSLSA-N |
| XLogP | 10.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.15 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|