C27H40NO+ — CID 11891404
(2R,3S,4S,5S,6S)-4-hexyl-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol (PubChem CID 11891404) has the molecular formula C27H40NO+ and a molecular weight of 394.62 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-4-hexyl-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3S,4S,5S,6S)-4-hexyl-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 11891404 |
| Molecular Formula | C27H40NO+ |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (2R,3S,4S,5S,6S)-4-hexyl-3-methyl-2,6-diphenyl-5-propylpiperidin-1-ium-4-ol |
| SMILES | CCCCCC[C@]1(O)[C@@H](C)[C@H](c2ccccc2)[NH2+][C@H](c2ccccc2)[C@@H]1CCC |
| InChI | InChI=1S/C27H39NO/c1-4-6-7-14-20-27(29)21(3)25(22-16-10-8-11-17-22)28-26(24(27)15-5-2)23-18-12-9-13-19-23/h8-13,16-19,21,24-26,28-29H,4-7,14-15,20H2,1-3H3/p+1/t21-,24-,25+,26+,27-/m0/s1 |
| InChIKey | DRYQTNXMKBICIH-ZYMCBDGHSA-O |
| XLogP | 5.80 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|