C11H14O3 — CID 130883145
(2R,3S,4S)-2-(hydroxymethyl)-4-phenyloxolan-3-ol (PubChem CID 130883145) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-4-phenyloxolan-3-ol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-4-phenyloxolan-3-ol |
|---|---|
| PubChem CID | 130883145 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-4-phenyloxolan-3-ol |
| SMILES | OC[C@H]1OC[C@H](c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C11H14O3/c12-6-10-11(13)9(7-14-10)8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | SLHRPTGSURJQFL-MXWKQRLJSA-N |
| XLogP | 0.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |