C10H10F2O — CID 13201699
(2,2-difluoro-3-phenylcyclopropyl)methanol (PubChem CID 13201699) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is (2,2-difluoro-3-phenylcyclopropyl)methanol.
| Compound Name | (2,2-difluoro-3-phenylcyclopropyl)methanol |
|---|---|
| PubChem CID | 13201699 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2,2-difluoro-3-phenylcyclopropyl)methanol |
| SMILES | OCC1C(c2ccccc2)C1(F)F |
| InChI | InChI=1S/C10H10F2O/c11-10(12)8(6-13)9(10)7-4-2-1-3-5-7/h1-5,8-9,13H,6H2 |
| InChIKey | BVRLGSCVBOXSSA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |