C15H20F2N2O2S — CID 146138540
1-[[(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methyl]piperidine-4-sulfonamide (PubChem CID 146138540) has the molecular formula C15H20F2N2O2S and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[[(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methyl]piperidine-4-sulfonamide.
| Compound Name | 1-[[(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 146138540 |
| Molecular Formula | C15H20F2N2O2S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[[(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methyl]piperidine-4-sulfonamide |
| SMILES | NS(=O)(=O)C1CCN(C[C@@H]2[C@@H](c3ccccc3)C2(F)F)CC1 |
| InChI | InChI=1S/C15H20F2N2O2S/c16-15(17)13(14(15)11-4-2-1-3-5-11)10-19-8-6-12(7-9-19)22(18,20)21/h1-5,12-14H,6-10H2,(H2,18,20,21)/t13-,14-/m1/s1 |
| InChIKey | DXQQEDYCASSNAO-ZIAGYGMSSA-N |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |