C16H25IN2O3S — CID 146138536
1-(3-phenylmethoxycyclobutyl)piperidine-4-sulfonamide;hydroiodide (PubChem CID 146138536) has the molecular formula C16H25IN2O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is 1-(3-phenylmethoxycyclobutyl)piperidine-4-sulfonamide;hydroiodide.
| Compound Name | 1-(3-phenylmethoxycyclobutyl)piperidine-4-sulfonamide;hydroiodide |
|---|---|
| PubChem CID | 146138536 |
| Molecular Formula | C16H25IN2O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 1-(3-phenylmethoxycyclobutyl)piperidine-4-sulfonamide;hydroiodide |
| SMILES | I.NS(=O)(=O)C1CCN(C2CC(OCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C16H24N2O3S.HI/c17-22(19,20)16-6-8-18(9-7-16)14-10-15(11-14)21-12-13-4-2-1-3-5-13;/h1-5,14-16H,6-12H2,(H2,17,19,20);1H |
| InChIKey | ZEAHGWNTGFLQAC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|