C9H7BF5K — CID 155982284
potassium [(3S)-2,2-difluoro-3-phenylcyclopropyl]-trifluoroboranuide (PubChem CID 155982284) has the molecular formula C9H7BF5K and a molecular weight of 260.06 g/mol. Its IUPAC name is potassium [(3S)-2,2-difluoro-3-phenylcyclopropyl]-trifluoroboranuide.
| Compound Name | potassium [(3S)-2,2-difluoro-3-phenylcyclopropyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 155982284 |
| Molecular Formula | C9H7BF5K |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | potassium [(3S)-2,2-difluoro-3-phenylcyclopropyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)C1[C@@H](c2ccccc2)C1(F)F.[K+] |
| InChI | InChI=1S/C9H7BF5.K/c11-9(12)7(8(9)10(13,14)15)6-4-2-1-3-5-6;/h1-5,7-8H;/q-1;+1/t7-,8?;/m1./s1 |
| InChIKey | ALSHDQKLSZXZAX-PGMKYVDRSA-N |
| XLogP | 0.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|