About benzyl(phenyl)iodanium tetrafluoroborate
benzyl(phenyl)iodanium tetrafluoroborate (PubChem CID 134880627) has the molecular formula C13H12BF4I
and a molecular weight of 381.95 g/mol. Its IUPAC name is benzyl(phenyl)iodanium tetrafluoroborate.
Molecular Properties
| Compound Name | benzyl(phenyl)iodanium tetrafluoroborate |
| PubChem CID | 134880627 |
| Molecular Formula | C13H12BF4I |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | benzyl(phenyl)iodanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(C[I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12I.BF4/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;2-1(3,4)5/h1-10H,11H2;/q+1;-1 |
| InChIKey | KHWXJNOHWREEHO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzyl(phenyl)iodanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(phenyl)iodanium tetrafluoroborate?
The IUPAC name of benzyl(phenyl)iodanium tetrafluoroborate (CID 134880627) is benzyl(phenyl)iodanium tetrafluoroborate.
What is the SMILES notation for benzyl(phenyl)iodanium tetrafluoroborate?
The canonical SMILES for benzyl(phenyl)iodanium tetrafluoroborate is F[B-](F)(F)F.c1ccc(C[I+]c2ccccc2)cc1.
What is the InChIKey of benzyl(phenyl)iodanium tetrafluoroborate?
The InChIKey is KHWXJNOHWREEHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12I.BF4/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;2-1(3,4)5/h1-10H,11H2;/q+1;-1.
What are the key properties of benzyl(phenyl)iodanium tetrafluoroborate?
benzyl(phenyl)iodanium tetrafluoroborate has a molecular weight of 381.95 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(phenyl)iodanium tetrafluoroborate is sourced from PubChem (CID 134880627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).