C15H17NO — CID 165340846
(1S,2S,5R,6S,7R)-4-methyl-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 165340846) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (1S,2S,5R,6S,7R)-4-methyl-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1S,2S,5R,6S,7R)-4-methyl-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 165340846 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (1S,2S,5R,6S,7R)-4-methyl-5-phenyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CN1O[C@@H]2[C@@H]([C@H]3C=C[C@@H]2C3)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c1-16-14(10-5-3-2-4-6-10)13-11-7-8-12(9-11)15(13)17-16/h2-8,11-15H,9H2,1H3/t11-,12+,13-,14-,15-/m0/s1 |
| InChIKey | AXKXSDFHUGEHHQ-AICCOOGYSA-N |
| XLogP | 2.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|