About (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine
(3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine (PubChem CID 102384469) has the molecular formula C14H22NO4P
and a molecular weight of 299.31 g/mol. Its IUPAC name is (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine |
| PubChem CID | 102384469 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine |
| SMILES | CCOP(=O)(OCC)[C@@H]1C[C@@H](c2ccccc2)ON1C |
| InChI | InChI=1S/C14H22NO4P/c1-4-17-20(16,18-5-2)14-11-13(19-15(14)3)12-9-7-6-8-10-12/h6-10,13-14H,4-5,11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | YZSQCIIMGMTSCK-UONOGXRCSA-N |
| XLogP | 3.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine?
The IUPAC name of (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine (CID 102384469) is (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine.
What is the SMILES notation for (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine?
The canonical SMILES for (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine is CCOP(=O)(OCC)[C@@H]1C[C@@H](c2ccccc2)ON1C.
What is the InChIKey of (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine?
The InChIKey is YZSQCIIMGMTSCK-UONOGXRCSA-N. The full InChI is InChI=1S/C14H22NO4P/c1-4-17-20(16,18-5-2)14-11-13(19-15(14)3)12-9-7-6-8-10-12/h6-10,13-14H,4-5,11H2,1-3H3/t13-,14+/m0/s1.
What are the key properties of (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine?
(3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine has a molecular weight of 299.31 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3-diethoxyphosphoryl-2-methyl-5-phenyl-1,2-oxazolidine is sourced from PubChem (CID 102384469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).