C14H21N2O6P — CID 72946242
(3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(2-nitrophenyl)-1,2-oxazolidine (PubChem CID 72946242) has the molecular formula C14H21N2O6P and a molecular weight of 344.30 g/mol. Its IUPAC name is (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(2-nitrophenyl)-1,2-oxazolidine.
| Compound Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(2-nitrophenyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 72946242 |
| Molecular Formula | C14H21N2O6P |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (3S,5R)-3-diethoxyphosphoryl-2-methyl-5-(2-nitrophenyl)-1,2-oxazolidine |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@H](c2ccccc2[N+](=O)[O-])ON1C |
| InChI | InChI=1S/C14H21N2O6P/c1-4-20-23(19,21-5-2)14-10-13(22-15(14)3)11-8-6-7-9-12(11)16(17)18/h6-9,13-14H,4-5,10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | UXLTTXLROXHCBN-KGLIPLIRSA-N |
| XLogP | 3.50 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|