C25H28O2 — CID 11810532
(4S,5S)-4,5-diphenyl-2-[(1R,2S,3S,4S)-3-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane (PubChem CID 11810532) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4S,5S)-4,5-diphenyl-2-[(1R,2S,3S,4S)-3-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane.
| Compound Name | (4S,5S)-4,5-diphenyl-2-[(1R,2S,3S,4S)-3-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11810532 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (4S,5S)-4,5-diphenyl-2-[(1R,2S,3S,4S)-3-propan-2-yl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
| SMILES | CC(C)[C@@H]1[C@@H](C2O[C@@H](c3ccccc3)[C@H](c3ccccc3)O2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C25H28O2/c1-16(2)21-19-13-14-20(15-19)22(21)25-26-23(17-9-5-3-6-10-17)24(27-25)18-11-7-4-8-12-18/h3-14,16,19-25H,15H2,1-2H3/t19-,20+,21+,22+,23+,24+/m1/s1 |
| InChIKey | JAMPJSVEDSBYNU-CKOZHMEPSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|