C17H20O2 — CID 101236572
2-[(1S,2R,3R,4R)-3-phenyl-2-bicyclo[2.2.2]oct-5-enyl]-1,3-dioxolane (PubChem CID 101236572) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-[(1S,2R,3R,4R)-3-phenyl-2-bicyclo[2.2.2]oct-5-enyl]-1,3-dioxolane.
| Compound Name | 2-[(1S,2R,3R,4R)-3-phenyl-2-bicyclo[2.2.2]oct-5-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 101236572 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(1S,2R,3R,4R)-3-phenyl-2-bicyclo[2.2.2]oct-5-enyl]-1,3-dioxolane |
| SMILES | C1=C[C@H]2CC[C@@H]1[C@@H](C1OCCO1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-2-4-12(5-3-1)15-13-6-8-14(9-7-13)16(15)17-18-10-11-19-17/h1-6,8,13-17H,7,9-11H2/t13-,14+,15+,16+/m0/s1 |
| InChIKey | RUIBTOUIJIFAJN-ZJIFWQFVSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|