C16H18 — CID 98158916
(1S,6S)-10-phenylbicyclo[4.3.1]deca-2,4-diene (PubChem CID 98158916) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is (1S,6S)-10-phenylbicyclo[4.3.1]deca-2,4-diene.
| Compound Name | (1S,6S)-10-phenylbicyclo[4.3.1]deca-2,4-diene |
|---|---|
| PubChem CID | 98158916 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1S,6S)-10-phenylbicyclo[4.3.1]deca-2,4-diene |
| SMILES | C1=C[C@@H]2CCC[C@@H](C=C1)C2c1ccccc1 |
| InChI | InChI=1S/C16H18/c1-2-7-13(8-3-1)16-14-9-4-5-10-15(16)12-6-11-14/h1-5,7-10,14-16H,6,11-12H2/t14-,15-/m1/s1 |
| InChIKey | JGLDFDBRZIAVTE-HUUCEWRRSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |