C9H12 — CID 12652500
2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 12652500) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 12652500 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C1=CC2CCCC2C=C1 |
| InChI | InChI=1S/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h1-2,4-5,8-9H,3,6-7H2 |
| InChIKey | SMBYEXNJVNACSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |