C11H15NO — CID 135190354
N-methoxy-3,4,4a,8a-tetrahydro-2H-naphthalen-1-imine (PubChem CID 135190354) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is N-methoxy-3,4,4a,8a-tetrahydro-2H-naphthalen-1-imine.
| Compound Name | N-methoxy-3,4,4a,8a-tetrahydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 135190354 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-methoxy-3,4,4a,8a-tetrahydro-2H-naphthalen-1-imine |
| SMILES | CON=C1CCCC2C=CC=CC12 |
| InChI | InChI=1S/C11H15NO/c1-13-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,9-10H,4,6,8H2,1H3 |
| InChIKey | HUBNBORNLDVXJM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|