C11H19N — CID 143180898
1,2,3,4,4a,8a-hexahydronaphthalene;methanamine (PubChem CID 143180898) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1,2,3,4,4a,8a-hexahydronaphthalene;methanamine.
| Compound Name | 1,2,3,4,4a,8a-hexahydronaphthalene;methanamine |
|---|---|
| PubChem CID | 143180898 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1,2,3,4,4a,8a-hexahydronaphthalene;methanamine |
| SMILES | C1=CC2CCCCC2C=C1.CN |
| InChI | InChI=1S/C10H14.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-2/h1-2,5-6,9-10H,3-4,7-8H2;2H2,1H3 |
| InChIKey | DOSKCDQCRNHNBB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |