C21H39Cl2NPTi- — CID 23232464
2,3,3a,7a-tetrahydro-1H-indene;dichlorotitanium;(tritert-butyl-λ5-phosphanylidene)azanide (PubChem CID 23232464) has the molecular formula C21H39Cl2NPTi- and a molecular weight of 455.30 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-indene;dichlorotitanium;(tritert-butyl-λ5-phosphanylidene)azanide.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-indene;dichlorotitanium;(tritert-butyl-λ5-phosphanylidene)azanide |
|---|---|
| PubChem CID | 23232464 |
| Molecular Formula | C21H39Cl2NPTi- |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-indene;dichlorotitanium;(tritert-butyl-λ5-phosphanylidene)azanide |
| SMILES | C1=CC2CCCC2C=C1.CC(C)(C)P(=[N-])(C(C)(C)C)C(C)(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/C12H27NP.C9H12.2ClH.Ti/c1-10(2,3)14(13,11(4,5)6)12(7,8)9;1-2-5-9-7-3-6-8(9)4-1;;;/h1-9H3;1-2,4-5,8-9H,3,6-7H2;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | RERBHOBLDKLWMA-UHFFFAOYSA-L |
| XLogP | 9.06 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|