C32H60N2O2 — CID 11060233
N-tert-butyl-N-[(1R,2Z,4R)-4-[(1R,2Z,4R)-4-(ditert-butylamino)oxycyclooct-2-en-1-yl]cyclooct-2-en-1-yl]oxy-2-methylpropan-2-amine (PubChem CID 11060233) has the molecular formula C32H60N2O2 and a molecular weight of 504.84 g/mol. Its IUPAC name is N-tert-butyl-N-[(1R,2Z,4R)-4-[(1R,2Z,4R)-4-(ditert-butylamino)oxycyclooct-2-en-1-yl]cyclooct-2-en-1-yl]oxy-2-methylpropan-2-amine.
| Compound Name | N-tert-butyl-N-[(1R,2Z,4R)-4-[(1R,2Z,4R)-4-(ditert-butylamino)oxycyclooct-2-en-1-yl]cyclooct-2-en-1-yl]oxy-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 11060233 |
| Molecular Formula | C32H60N2O2 |
| Molecular Weight | 504.84 g/mol |
| Exact Mass | 504.47 |
| IUPAC Name | N-tert-butyl-N-[(1R,2Z,4R)-4-[(1R,2Z,4R)-4-(ditert-butylamino)oxycyclooct-2-en-1-yl]cyclooct-2-en-1-yl]oxy-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N(O[C@H]1/C=C\[C@H]([C@H]2/C=C\[C@H](ON(C(C)(C)C)C(C)(C)C)CCCC2)CCCC1)C(C)(C)C |
| InChI | InChI=1S/C32H60N2O2/c1-29(2,3)33(30(4,5)6)35-27-19-15-13-17-25(21-23-27)26-18-14-16-20-28(24-22-26)36-34(31(7,8)9)32(10,11)12/h21-28H,13-20H2,1-12H3/b23-21-,24-22-/t25-,26-,27-,28-/m1/s1 |
| InChIKey | GFGULJIAPGTSOI-KGHCNLCVSA-N |
| XLogP | 8.88 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.84 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|