C13H22O4 — CID 118458845
tert-butyl [(2E)-4-hydroxycyclooct-2-en-1-yl] carbonate (PubChem CID 118458845) has the molecular formula C13H22O4 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl [(2E)-4-hydroxycyclooct-2-en-1-yl] carbonate.
| Compound Name | tert-butyl [(2E)-4-hydroxycyclooct-2-en-1-yl] carbonate |
|---|---|
| PubChem CID | 118458845 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | tert-butyl [(2E)-4-hydroxycyclooct-2-en-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC1/C=C\C(O)CCCC1 |
| InChI | InChI=1S/C13H22O4/c1-13(2,3)17-12(15)16-11-7-5-4-6-10(14)8-9-11/h8-11,14H,4-7H2,1-3H3/b9-8- |
| InChIKey | WNYXFFKGBQUNDA-HJWRWDBZSA-N |
| XLogP | 2.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|